C22H27ClN4O4S — CID 46020635
N-(3-chlorophenyl)-4-[2-(2-methoxyethylamino)-2-oxo-1-(thiophene-2-carbonylamino)ethyl]piperidine-1-carboxamide (PubChem CID 46020635) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-(2-methoxyethylamino)-2-oxo-1-(thiophene-2-carbonylamino)ethyl]piperidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[2-(2-methoxyethylamino)-2-oxo-1-(thiophene-2-carbonylamino)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46020635 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-(2-methoxyethylamino)-2-oxo-1-(thiophene-2-carbonylamino)ethyl]piperidine-1-carboxamide |
| SMILES | COCCNC(=O)C(NC(=O)c1cccs1)C1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-31-12-9-24-21(29)19(26-20(28)18-6-3-13-32-18)15-7-10-27(11-8-15)22(30)25-17-5-2-4-16(23)14-17/h2-6,13-15,19H,7-12H2,1H3,(H,24,29)(H,25,30)(H,26,28) |
| InChIKey | LMHXUUSQXKUEFO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|