C18H27N3O4S — CID 93196917
N-[(1R)-2-(2-methoxyethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]thiophene-2-carboxamide (PubChem CID 93196917) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(1R)-2-(2-methoxyethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-2-(2-methoxyethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 93196917 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(1R)-2-(2-methoxyethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CCC(=O)N1CCC([C@@H](NC(=O)c2cccs2)C(=O)NCCOC)CC1 |
| InChI | InChI=1S/C18H27N3O4S/c1-3-15(22)21-9-6-13(7-10-21)16(18(24)19-8-11-25-2)20-17(23)14-5-4-12-26-14/h4-5,12-13,16H,3,6-11H2,1-2H3,(H,19,24)(H,20,23)/t16-/m1/s1 |
| InChIKey | MYPDEFBLRZIRSH-MRXNPFEDSA-N |
| XLogP | 1.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|