C19H28N4O3S — CID 46020639
4-[2-oxo-2-(prop-2-enylamino)-1-(thiophene-2-carbonylamino)ethyl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 46020639) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-[2-oxo-2-(prop-2-enylamino)-1-(thiophene-2-carbonylamino)ethyl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[2-oxo-2-(prop-2-enylamino)-1-(thiophene-2-carbonylamino)ethyl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46020639 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[2-oxo-2-(prop-2-enylamino)-1-(thiophene-2-carbonylamino)ethyl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | C=CCNC(=O)C(NC(=O)c1cccs1)C1CCN(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C19H28N4O3S/c1-4-9-20-18(25)16(22-17(24)15-6-5-12-27-15)14-7-10-23(11-8-14)19(26)21-13(2)3/h4-6,12-14,16H,1,7-11H2,2-3H3,(H,20,25)(H,21,26)(H,22,24) |
| InChIKey | PFSGPWXEGOPZLQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|