C20H25N5O5S2 — CID 55698247
4-morpholin-4-ylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]piperazine-1-carboxamide (PubChem CID 55698247) has the molecular formula C20H25N5O5S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-morpholin-4-ylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55698247 |
| Molecular Formula | C20H25N5O5S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)N2CCN(S(=O)(=O)N3CCOCC3)CC2)c1)c1cccs1 |
| InChI | InChI=1S/C20H25N5O5S2/c26-19(18-5-2-14-31-18)21-16-3-1-4-17(15-16)22-20(27)23-6-8-24(9-7-23)32(28,29)25-10-12-30-13-11-25/h1-5,14-15H,6-13H2,(H,21,26)(H,22,27) |
| InChIKey | UUNNZRAAPMHQMI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |