C17H19N3O4S2 — CID 46532752
N-[3-(4-methylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 46532752) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[3-(4-methylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(4-methylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46532752 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[3-(4-methylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cccc(NC(=O)c3cccs3)c2)CC1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-26(23,24)20-9-7-19(8-10-20)17(22)13-4-2-5-14(12-13)18-16(21)15-6-3-11-25-15/h2-6,11-12H,7-10H2,1H3,(H,18,21) |
| InChIKey | ZNNKYVXHYIPREV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |