C16H16N2O3S — CID 653867
N-[4-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 653867) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[4-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 653867 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[4-(morpholine-4-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCOCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H16N2O3S/c19-15(14-2-1-11-22-14)17-13-5-3-12(4-6-13)16(20)18-7-9-21-10-8-18/h1-6,11H,7-10H2,(H,17,19) |
| InChIKey | OACWYJNHXKFZBE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |