C21H27N3O3S — CID 25473941
N-[4-[[(2R)-3-methyl-2-morpholin-4-ylbutyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 25473941) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[4-[[(2R)-3-methyl-2-morpholin-4-ylbutyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[(2R)-3-methyl-2-morpholin-4-ylbutyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25473941 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[4-[[(2R)-3-methyl-2-morpholin-4-ylbutyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)[C@H](CNC(=O)c1ccc(NC(=O)c2cccs2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H27N3O3S/c1-15(2)18(24-9-11-27-12-10-24)14-22-20(25)16-5-7-17(8-6-16)23-21(26)19-4-3-13-28-19/h3-8,13,15,18H,9-12,14H2,1-2H3,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | SYARRQYYAXJCLM-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |