C22H22N4O3S — CID 29320346
N-[4-[(6-morpholin-4-yl-3-pyridinyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 29320346) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[4-[(6-morpholin-4-yl-3-pyridinyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(6-morpholin-4-yl-3-pyridinyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 29320346 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[4-[(6-morpholin-4-yl-3-pyridinyl)methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCOCC2)nc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c27-21(17-4-6-18(7-5-17)25-22(28)19-2-1-13-30-19)24-15-16-3-8-20(23-14-16)26-9-11-29-12-10-26/h1-8,13-14H,9-12,15H2,(H,24,27)(H,25,28) |
| InChIKey | SXSBRTQIZXADAS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |