C23H20N4O2S2 — CID 163920324
N-[6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1,3-benzothiazol-2-yl]-4-methylbenzamide (PubChem CID 163920324) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1,3-benzothiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1,3-benzothiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 163920324 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1,3-benzothiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3ccc(NC(=O)CSc4ccc(N)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C23H20N4O2S2/c1-14-2-4-15(5-3-14)22(29)27-23-26-19-11-8-17(12-20(19)31-23)25-21(28)13-30-18-9-6-16(24)7-10-18/h2-12H,13,24H2,1H3,(H,25,28)(H,26,27,29) |
| InChIKey | MCGGGPDKNWZDMP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|