C24H18F3N3O2S2 — CID 158956981
N-[6-[3-(4-aminophenyl)sulfanyl-2-oxopropyl]-1,3-benzothiazol-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 158956981) has the molecular formula C24H18F3N3O2S2 and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[6-[3-(4-aminophenyl)sulfanyl-2-oxopropyl]-1,3-benzothiazol-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[3-(4-aminophenyl)sulfanyl-2-oxopropyl]-1,3-benzothiazol-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 158956981 |
| Molecular Formula | C24H18F3N3O2S2 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N-[6-[3-(4-aminophenyl)sulfanyl-2-oxopropyl]-1,3-benzothiazol-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(SCC(=O)Cc2ccc3nc(NC(=O)c4ccc(C(F)(F)F)cc4)sc3c2)cc1 |
| InChI | InChI=1S/C24H18F3N3O2S2/c25-24(26,27)16-4-2-15(3-5-16)22(32)30-23-29-20-10-1-14(12-21(20)34-23)11-18(31)13-33-19-8-6-17(28)7-9-19/h1-10,12H,11,13,28H2,(H,29,30,32) |
| InChIKey | JMCZGVGKHXETOD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|