C19H20ClFN2O4 — CID 74374708
6-[[3-(5-chlorofuran-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide (PubChem CID 74374708) has the molecular formula C19H20ClFN2O4 and a molecular weight of 394.83 g/mol. Its IUPAC name is 6-[[3-(5-chlorofuran-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[3-(5-chlorofuran-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 74374708 |
| Molecular Formula | C19H20ClFN2O4 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-[[3-(5-chlorofuran-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)C(=Cc1ccc(Cl)o1)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C19H20ClFN2O4/c20-17-10-9-15(27-17)12-16(13-5-7-14(21)8-6-13)19(25)22-11-3-1-2-4-18(24)23-26/h5-10,12,26H,1-4,11H2,(H,22,25)(H,23,24) |
| InChIKey | PEBCKTAUXHIZOU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|