C28H27N3O5 — CID 59575493
4-[[[4-[(E)-3-(cyclopropylamino)-2-(4-methoxyphenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 59575493) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[[[4-[(E)-3-(cyclopropylamino)-2-(4-methoxyphenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[[4-[(E)-3-(cyclopropylamino)-2-(4-methoxyphenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 59575493 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[[[4-[(E)-3-(cyclopropylamino)-2-(4-methoxyphenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | COc1ccc(/C(=C\c2ccc(C(=O)NCc3ccc(C(=O)NO)cc3)cc2)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C28H27N3O5/c1-36-24-14-10-20(11-15-24)25(28(34)30-23-12-13-23)16-18-2-6-21(7-3-18)26(32)29-17-19-4-8-22(9-5-19)27(33)31-35/h2-11,14-16,23,35H,12-13,17H2,1H3,(H,29,32)(H,30,34)(H,31,33)/b25-16+ |
| InChIKey | GBEDSMXGIYVNTG-PCLIKHOPSA-N |
| XLogP | 3.56 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|