C30H28FN3O5 — CID 25271482
4-[[[(E)-3-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 25271482) has the molecular formula C30H28FN3O5 and a molecular weight of 529.57 g/mol. Its IUPAC name is 4-[[[(E)-3-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[[(E)-3-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 25271482 |
| Molecular Formula | C30H28FN3O5 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-[[[(E)-3-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | O=C(/C=C/c1ccc(/C=C(/C(=O)N2CCOCC2)c2ccc(F)cc2)cc1)NCc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C30H28FN3O5/c31-26-12-10-24(11-13-26)27(30(37)34-15-17-39-18-16-34)19-22-3-1-21(2-4-22)7-14-28(35)32-20-23-5-8-25(9-6-23)29(36)33-38/h1-14,19,38H,15-18,20H2,(H,32,35)(H,33,36)/b14-7+,27-19+ |
| InChIKey | YBTPYDNYMZBJRX-QARLKVNISA-N |
| XLogP | 3.67 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|