C34H35FN2O5 — CID 143796431
1-[4-[[[2-[(E)-2-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]ethenyl]oxiran-2-yl]amino]methyl]phenyl]-4-hydroxybutan-1-one (PubChem CID 143796431) has the molecular formula C34H35FN2O5 and a molecular weight of 570.66 g/mol. Its IUPAC name is 1-[4-[[[2-[(E)-2-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]ethenyl]oxiran-2-yl]amino]methyl]phenyl]-4-hydroxybutan-1-one.
| Compound Name | 1-[4-[[[2-[(E)-2-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]ethenyl]oxiran-2-yl]amino]methyl]phenyl]-4-hydroxybutan-1-one |
|---|---|
| PubChem CID | 143796431 |
| Molecular Formula | C34H35FN2O5 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 1-[4-[[[2-[(E)-2-[4-[(E)-2-(4-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]ethenyl]oxiran-2-yl]amino]methyl]phenyl]-4-hydroxybutan-1-one |
| SMILES | O=C(CCCO)c1ccc(CNC2(/C=C/c3ccc(/C=C(/C(=O)N4CCOCC4)c4ccc(F)cc4)cc3)CO2)cc1 |
| InChI | InChI=1S/C34H35FN2O5/c35-30-13-11-28(12-14-30)31(33(40)37-17-20-41-21-18-37)22-26-5-3-25(4-6-26)15-16-34(24-42-34)36-23-27-7-9-29(10-8-27)32(39)2-1-19-38/h3-16,22,36,38H,1-2,17-21,23-24H2/b16-15+,31-22+ |
| InChIKey | OXJBAYGQZHFYHE-OQBFKNBXSA-N |
| XLogP | 4.71 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|