C28H32FN3O5 — CID 87451076
6-[3-[4-[(E)-2-(2-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]-N-hydroxyhexanamide (PubChem CID 87451076) has the molecular formula C28H32FN3O5 and a molecular weight of 509.58 g/mol. Its IUPAC name is 6-[3-[4-[(E)-2-(2-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[3-[4-[(E)-2-(2-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87451076 |
| Molecular Formula | C28H32FN3O5 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 6-[3-[4-[(E)-2-(2-fluorophenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]-N-hydroxyhexanamide |
| SMILES | O=C(C=Cc1ccc(/C=C(/C(=O)N2CCOCC2)c2ccccc2F)cc1)NCCCCCC(=O)NO |
| InChI | InChI=1S/C28H32FN3O5/c29-25-7-4-3-6-23(25)24(28(35)32-16-18-37-19-17-32)20-22-11-9-21(10-12-22)13-14-26(33)30-15-5-1-2-8-27(34)31-36/h3-4,6-7,9-14,20,36H,1-2,5,8,15-19H2,(H,30,33)(H,31,34)/b14-13?,24-20+ |
| InChIKey | AEFMFIUYFOUCAI-AQFPFVGQSA-N |
| XLogP | 3.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|