C26H40N2O5 — CID 21337225
(E)-N-hexyl-3-[3-methoxy-4-(6-morpholin-4-yl-6-oxohexoxy)phenyl]prop-2-enamide (PubChem CID 21337225) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is (E)-N-hexyl-3-[3-methoxy-4-(6-morpholin-4-yl-6-oxohexoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-hexyl-3-[3-methoxy-4-(6-morpholin-4-yl-6-oxohexoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21337225 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | (E)-N-hexyl-3-[3-methoxy-4-(6-morpholin-4-yl-6-oxohexoxy)phenyl]prop-2-enamide |
| SMILES | CCCCCCNC(=O)/C=C/c1ccc(OCCCCCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C26H40N2O5/c1-3-4-5-8-15-27-25(29)14-12-22-11-13-23(24(21-22)31-2)33-18-9-6-7-10-26(30)28-16-19-32-20-17-28/h11-14,21H,3-10,15-20H2,1-2H3,(H,27,29)/b14-12+ |
| InChIKey | GCCJPCZHJNQQIW-WYMLVPIESA-N |
| XLogP | 4.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|