C22H19BrO2S — CID 168869917
1-[4-(3-bromopropoxy)phenyl]-3-(2-thiophen-2-ylphenyl)prop-2-en-1-one (PubChem CID 168869917) has the molecular formula C22H19BrO2S and a molecular weight of 427.36 g/mol. Its IUPAC name is 1-[4-(3-bromopropoxy)phenyl]-3-(2-thiophen-2-ylphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(3-bromopropoxy)phenyl]-3-(2-thiophen-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 168869917 |
| Molecular Formula | C22H19BrO2S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-[4-(3-bromopropoxy)phenyl]-3-(2-thiophen-2-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1-c1cccs1)c1ccc(OCCCBr)cc1 |
| InChI | InChI=1S/C22H19BrO2S/c23-14-4-15-25-19-11-8-18(9-12-19)21(24)13-10-17-5-1-2-6-20(17)22-7-3-16-26-22/h1-3,5-13,16H,4,14-15H2 |
| InChIKey | DEXHEPJYBNXCGY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|