C30H30F2N6O4 — CID 144690316
(E)-1-[4-[(Z)-2-amino-3-[amino-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]amino]prop-2-enoxy]phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 144690316) has the molecular formula C30H30F2N6O4 and a molecular weight of 576.60 g/mol. Its IUPAC name is (E)-1-[4-[(Z)-2-amino-3-[amino-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]amino]prop-2-enoxy]phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(Z)-2-amino-3-[amino-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]amino]prop-2-enoxy]phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 144690316 |
| Molecular Formula | C30H30F2N6O4 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (E)-1-[4-[(Z)-2-amino-3-[amino-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]amino]prop-2-enoxy]phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC/C(N)=C/N(N)CC(O)(Cn3cncn3)c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C30H30F2N6O4/c1-41-25-8-2-21(3-9-25)4-13-29(39)22-5-10-26(11-6-22)42-16-24(33)15-37(34)17-30(40,18-38-20-35-19-36-38)27-12-7-23(31)14-28(27)32/h2-15,19-20,40H,16-18,33-34H2,1H3/b13-4+,24-15- |
| InChIKey | IWMPLGUZCDYJHR-MPYXYYBISA-N |
| XLogP | 3.40 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|