C35H30F2N6O4 — CID 78321705
(1E,4E)-1-(4-buta-2,3-dienoxyphenyl)-5-[4-[[1-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]triazol-4-yl]methoxy]phenyl]penta-1,4-dien-3-one (PubChem CID 78321705) has the molecular formula C35H30F2N6O4 and a molecular weight of 636.66 g/mol. Its IUPAC name is (1E,4E)-1-(4-buta-2,3-dienoxyphenyl)-5-[4-[[1-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]triazol-4-yl]methoxy]phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-buta-2,3-dienoxyphenyl)-5-[4-[[1-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]triazol-4-yl]methoxy]phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 78321705 |
| Molecular Formula | C35H30F2N6O4 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | (1E,4E)-1-(4-buta-2,3-dienoxyphenyl)-5-[4-[[1-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]triazol-4-yl]methoxy]phenyl]penta-1,4-dien-3-one |
| SMILES | C=C=CCOc1ccc(/C=C/C(=O)/C=C/c2ccc(OCc3cn(CC(O)(Cn4cncn4)c4ccc(F)cc4F)nn3)cc2)cc1 |
| InChI | InChI=1S/C35H30F2N6O4/c1-2-3-18-46-31-13-6-26(7-14-31)4-11-30(44)12-5-27-8-15-32(16-9-27)47-21-29-20-42(41-40-29)22-35(45,23-43-25-38-24-39-43)33-17-10-28(36)19-34(33)37/h3-17,19-20,24-25,45H,1,18,21-23H2/b11-4+,12-5+ |
| InChIKey | NXIVBBYEFBZWFR-JLYPQOKGSA-N |
| XLogP | 5.33 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|