C9H9BrClNO — CID 18630175
2-bromo-5-chloro-N-ethylbenzamide (PubChem CID 18630175) has the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-ethylbenzamide.
| Compound Name | 2-bromo-5-chloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 18630175 |
| Molecular Formula | C9H9BrClNO |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-bromo-5-chloro-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C9H9BrClNO/c1-2-12-9(13)7-5-6(11)3-4-8(7)10/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | MJOWAHWJUNOQFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |