C16H21BrClNO3 — CID 78901898
ethyl 7-[(2-bromo-5-chlorobenzoyl)amino]heptanoate (PubChem CID 78901898) has the molecular formula C16H21BrClNO3 and a molecular weight of 390.71 g/mol. Its IUPAC name is ethyl 7-[(2-bromo-5-chlorobenzoyl)amino]heptanoate.
| Compound Name | ethyl 7-[(2-bromo-5-chlorobenzoyl)amino]heptanoate |
|---|---|
| PubChem CID | 78901898 |
| Molecular Formula | C16H21BrClNO3 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | ethyl 7-[(2-bromo-5-chlorobenzoyl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC(=O)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C16H21BrClNO3/c1-2-22-15(20)7-5-3-4-6-10-19-16(21)13-11-12(18)8-9-14(13)17/h8-9,11H,2-7,10H2,1H3,(H,19,21) |
| InChIKey | PQEKSZLVTCSVIR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|