C48H66N6O12 — CID 127037235
2,3,4-trihydroxy-N-[4-[[2,4,6-triethyl-3,5-bis[[4-[(2,3,4-trihydroxybenzoyl)amino]butylamino]methyl]phenyl]methylamino]butyl]benzamide (PubChem CID 127037235) has the molecular formula C48H66N6O12 and a molecular weight of 919.09 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-[4-[[2,4,6-triethyl-3,5-bis[[4-[(2,3,4-trihydroxybenzoyl)amino]butylamino]methyl]phenyl]methylamino]butyl]benzamide.
| Compound Name | 2,3,4-trihydroxy-N-[4-[[2,4,6-triethyl-3,5-bis[[4-[(2,3,4-trihydroxybenzoyl)amino]butylamino]methyl]phenyl]methylamino]butyl]benzamide |
|---|---|
| PubChem CID | 127037235 |
| Molecular Formula | C48H66N6O12 |
| Molecular Weight | 919.09 g/mol |
| Exact Mass | 918.47 |
| IUPAC Name | 2,3,4-trihydroxy-N-[4-[[2,4,6-triethyl-3,5-bis[[4-[(2,3,4-trihydroxybenzoyl)amino]butylamino]methyl]phenyl]methylamino]butyl]benzamide |
| SMILES | CCc1c(CNCCCCNC(=O)c2ccc(O)c(O)c2O)c(CC)c(CNCCCCNC(=O)c2ccc(O)c(O)c2O)c(CC)c1CNCCCCNC(=O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C48H66N6O12/c1-4-28-34(25-49-19-7-10-22-52-46(64)31-13-16-37(55)43(61)40(31)58)29(5-2)36(27-51-21-9-12-24-54-48(66)33-15-18-39(57)45(63)42(33)60)30(6-3)35(28)26-50-20-8-11-23-53-47(65)32-14-17-38(56)44(62)41(32)59/h13-18,49-51,55-63H,4-12,19-27H2,1-3H3,(H,52,64)(H,53,65)(H,54,66) |
| InChIKey | KAOJUSUFBKSBER-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 305.46 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.09 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|