C20H24N2O6 — CID 163133324
2,3-dihydroxy-N-[1-hydroxy-6-[(2-hydroxybenzoyl)amino]hexan-2-yl]benzamide (PubChem CID 163133324) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[1-hydroxy-6-[(2-hydroxybenzoyl)amino]hexan-2-yl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[1-hydroxy-6-[(2-hydroxybenzoyl)amino]hexan-2-yl]benzamide |
|---|---|
| PubChem CID | 163133324 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2,3-dihydroxy-N-[1-hydroxy-6-[(2-hydroxybenzoyl)amino]hexan-2-yl]benzamide |
| SMILES | O=C(NCCCCC(CO)NC(=O)c1cccc(O)c1O)c1ccccc1O |
| InChI | InChI=1S/C20H24N2O6/c23-12-13(22-20(28)15-8-5-10-17(25)18(15)26)6-3-4-11-21-19(27)14-7-1-2-9-16(14)24/h1-2,5,7-10,13,23-26H,3-4,6,11-12H2,(H,21,27)(H,22,28) |
| InChIKey | GZKHCSFVZUPXMA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|