C20H23FN2O6 — CID 163126979
N-[6-[(2-fluoro-6-hydroxybenzoyl)amino]-1-hydroxyhexan-2-yl]-2,3-dihydroxybenzamide (PubChem CID 163126979) has the molecular formula C20H23FN2O6 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[6-[(2-fluoro-6-hydroxybenzoyl)amino]-1-hydroxyhexan-2-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[6-[(2-fluoro-6-hydroxybenzoyl)amino]-1-hydroxyhexan-2-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 163126979 |
| Molecular Formula | C20H23FN2O6 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[6-[(2-fluoro-6-hydroxybenzoyl)amino]-1-hydroxyhexan-2-yl]-2,3-dihydroxybenzamide |
| SMILES | O=C(NC(CO)CCCCNC(=O)c1c(O)cccc1F)c1cccc(O)c1O |
| InChI | InChI=1S/C20H23FN2O6/c21-14-7-4-8-15(25)17(14)20(29)22-10-2-1-5-12(11-24)23-19(28)13-6-3-9-16(26)18(13)27/h3-4,6-9,12,24-27H,1-2,5,10-11H2,(H,22,29)(H,23,28) |
| InChIKey | DRJKUWDQCHORCJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|