C20H24N2O5 — CID 118988697
2-hydroxy-N-[(5S)-6-hydroxy-5-[(2-hydroxybenzoyl)amino]hexyl]benzamide (PubChem CID 118988697) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-hydroxy-N-[(5S)-6-hydroxy-5-[(2-hydroxybenzoyl)amino]hexyl]benzamide.
| Compound Name | 2-hydroxy-N-[(5S)-6-hydroxy-5-[(2-hydroxybenzoyl)amino]hexyl]benzamide |
|---|---|
| PubChem CID | 118988697 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-hydroxy-N-[(5S)-6-hydroxy-5-[(2-hydroxybenzoyl)amino]hexyl]benzamide |
| SMILES | O=C(NCCCC[C@@H](CO)NC(=O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C20H24N2O5/c23-13-14(22-20(27)16-9-2-4-11-18(16)25)7-5-6-12-21-19(26)15-8-1-3-10-17(15)24/h1-4,8-11,14,23-25H,5-7,12-13H2,(H,21,26)(H,22,27)/t14-/m0/s1 |
| InChIKey | LHXWNUSSHMYIGT-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|