C14H23N3O3 — CID 56991372
N-(1,7-diaminoheptan-2-yl)-2,3-dihydroxybenzamide (PubChem CID 56991372) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(1,7-diaminoheptan-2-yl)-2,3-dihydroxybenzamide.
| Compound Name | N-(1,7-diaminoheptan-2-yl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 56991372 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(1,7-diaminoheptan-2-yl)-2,3-dihydroxybenzamide |
| SMILES | NCCCCCC(CN)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H23N3O3/c15-8-3-1-2-5-10(9-16)17-14(20)11-6-4-7-12(18)13(11)19/h4,6-7,10,18-19H,1-3,5,8-9,15-16H2,(H,17,20) |
| InChIKey | PRBLEDOZKBSGRB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|