C24H34N4O8 — CID 145201876
2,3-dihydroxy-N-(2-hydroxypropyl)benzamide;N-[3-(3-formamidopropylamino)propyl]-2,3-dihydroxybenzamide (PubChem CID 145201876) has the molecular formula C24H34N4O8 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-hydroxypropyl)benzamide;N-[3-(3-formamidopropylamino)propyl]-2,3-dihydroxybenzamide.
| Compound Name | 2,3-dihydroxy-N-(2-hydroxypropyl)benzamide;N-[3-(3-formamidopropylamino)propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 145201876 |
| Molecular Formula | C24H34N4O8 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2,3-dihydroxy-N-(2-hydroxypropyl)benzamide;N-[3-(3-formamidopropylamino)propyl]-2,3-dihydroxybenzamide |
| SMILES | CC(O)CNC(=O)c1cccc(O)c1O.O=CNCCCNCCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H21N3O4.C10H13NO4/c18-10-16-8-2-6-15-7-3-9-17-14(21)11-4-1-5-12(19)13(11)20;1-6(12)5-11-10(15)7-3-2-4-8(13)9(7)14/h1,4-5,10,15,19-20H,2-3,6-9H2,(H,16,18)(H,17,21);2-4,6,12-14H,5H2,1H3,(H,11,15) |
| InChIKey | IRXLXFNAGMRLST-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 200.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|