C21H35N5O7 — CID 102077913
N-[3-[3-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]propylamino]propyl]-2,3-dihydroxybenzamide (PubChem CID 102077913) has the molecular formula C21H35N5O7 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[3-[3-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]propylamino]propyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-[3-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]propylamino]propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 102077913 |
| Molecular Formula | C21H35N5O7 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[3-[3-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]propylamino]propyl]-2,3-dihydroxybenzamide |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](C(=O)NCCCNCCCNC(=O)c1cccc(O)c1O)[C@@H](C)O |
| InChI | InChI=1S/C21H35N5O7/c1-12(27)16(22)20(32)26-17(13(2)28)21(33)25-11-5-9-23-8-4-10-24-19(31)14-6-3-7-15(29)18(14)30/h3,6-7,12-13,16-17,23,27-30H,4-5,8-11,22H2,1-2H3,(H,24,31)(H,25,33)(H,26,32)/t12-,13-,16+,17+/m1/s1 |
| InChIKey | ZDEKEZOAYVBYGQ-OMNBBPDLSA-N |
| XLogP | -2.11 |
| TPSA | 206.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|