C21H35N5O7 — CID 134972228
N-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]amino]propyl]amino]propyl]-2,3-dihydroxybenzamide (PubChem CID 134972228) has the molecular formula C21H35N5O7 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]amino]propyl]amino]propyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]amino]propyl]amino]propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 134972228 |
| Molecular Formula | C21H35N5O7 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]-[3-[[(2R,3S)-2-amino-3-hydroxybutanoyl]amino]propyl]amino]propyl]-2,3-dihydroxybenzamide |
| SMILES | C[C@H](O)C(N)C(=O)N(CCCNC(=O)c1cccc(O)c1O)CCCNC(=O)[C@H](N)[C@H](C)O |
| InChI | InChI=1S/C21H35N5O7/c1-12(27)16(22)20(32)25-9-5-11-26(21(33)17(23)13(2)28)10-4-8-24-19(31)14-6-3-7-15(29)18(14)30/h3,6-7,12-13,16-17,27-30H,4-5,8-11,22-23H2,1-2H3,(H,24,31)(H,25,32)/t12-,13-,16+,17?/m0/s1 |
| InChIKey | ZYXZAXBWZHPAMM-FGLHLUCPSA-N |
| XLogP | -2.03 |
| TPSA | 211.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|