C30H42IN5O9 — CID 145020457
N'-[4-[(2,3-dihydroxybenzoyl)amino]butyl]-N'-[3-[(2,3-dihydroxybenzoyl)amino]propyl]-N-[5-[hydroxy(iodo)amino]pentyl]butanediamide (PubChem CID 145020457) has the molecular formula C30H42IN5O9 and a molecular weight of 743.60 g/mol. Its IUPAC name is N'-[4-[(2,3-dihydroxybenzoyl)amino]butyl]-N'-[3-[(2,3-dihydroxybenzoyl)amino]propyl]-N-[5-[hydroxy(iodo)amino]pentyl]butanediamide.
| Compound Name | N'-[4-[(2,3-dihydroxybenzoyl)amino]butyl]-N'-[3-[(2,3-dihydroxybenzoyl)amino]propyl]-N-[5-[hydroxy(iodo)amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 145020457 |
| Molecular Formula | C30H42IN5O9 |
| Molecular Weight | 743.60 g/mol |
| Exact Mass | 743.20 |
| IUPAC Name | N'-[4-[(2,3-dihydroxybenzoyl)amino]butyl]-N'-[3-[(2,3-dihydroxybenzoyl)amino]propyl]-N-[5-[hydroxy(iodo)amino]pentyl]butanediamide |
| SMILES | O=C(CCC(=O)N(CCCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O)NCCCCCN(O)I |
| InChI | InChI=1S/C30H42IN5O9/c31-36(45)20-4-1-2-15-32-25(39)13-14-26(40)35(19-8-17-34-30(44)22-10-7-12-24(38)28(22)42)18-5-3-16-33-29(43)21-9-6-11-23(37)27(21)41/h6-7,9-12,37-38,41-42,45H,1-5,8,13-20H2,(H,32,39)(H,33,43)(H,34,44) |
| InChIKey | RODGHIPKQAPSDH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 212.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|