C29H41N5O9 — CID 102369370
N-[4-[3-[3-[acetyl(hydroxy)amino]propanoylamino]propyl]-4-amino-7-[(2,3-dihydroxybenzoyl)amino]heptyl]-2,3-dihydroxybenzamide (PubChem CID 102369370) has the molecular formula C29H41N5O9 and a molecular weight of 603.67 g/mol. Its IUPAC name is N-[4-[3-[3-[acetyl(hydroxy)amino]propanoylamino]propyl]-4-amino-7-[(2,3-dihydroxybenzoyl)amino]heptyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4-[3-[3-[acetyl(hydroxy)amino]propanoylamino]propyl]-4-amino-7-[(2,3-dihydroxybenzoyl)amino]heptyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 102369370 |
| Molecular Formula | C29H41N5O9 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | N-[4-[3-[3-[acetyl(hydroxy)amino]propanoylamino]propyl]-4-amino-7-[(2,3-dihydroxybenzoyl)amino]heptyl]-2,3-dihydroxybenzamide |
| SMILES | CC(=O)N(O)CCC(=O)NCCCC(N)(CCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C29H41N5O9/c1-19(35)34(43)18-11-24(38)31-15-4-12-29(30,13-5-16-32-27(41)20-7-2-9-22(36)25(20)39)14-6-17-33-28(42)21-8-3-10-23(37)26(21)40/h2-3,7-10,36-37,39-40,43H,4-6,11-18,30H2,1H3,(H,31,38)(H,32,41)(H,33,42) |
| InChIKey | NEFQHKUVXOJZKF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 234.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|