C12H17NO10P2-2 — CID 23421513
[5-[(2,3-dihydroxybenzoyl)amino]-1-hydroxy-1-[hydroxy(oxido)phosphoryl]pentyl]-hydroxyphosphinate (PubChem CID 23421513) has the molecular formula C12H17NO10P2-2 and a molecular weight of 397.21 g/mol. Its IUPAC name is [5-[(2,3-dihydroxybenzoyl)amino]-1-hydroxy-1-[hydroxy(oxido)phosphoryl]pentyl]-hydroxyphosphinate.
| Compound Name | [5-[(2,3-dihydroxybenzoyl)amino]-1-hydroxy-1-[hydroxy(oxido)phosphoryl]pentyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 23421513 |
| Molecular Formula | C12H17NO10P2-2 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | [5-[(2,3-dihydroxybenzoyl)amino]-1-hydroxy-1-[hydroxy(oxido)phosphoryl]pentyl]-hydroxyphosphinate |
| SMILES | O=C(NCCCCC(O)(P(=O)([O-])O)P(=O)([O-])O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H19NO10P2/c14-9-5-3-4-8(10(9)15)11(16)13-7-2-1-6-12(17,24(18,19)20)25(21,22)23/h3-5,14-15,17H,1-2,6-7H2,(H,13,16)(H2,18,19,20)(H2,21,22,23)/p-2 |
| InChIKey | PZMAJWGHGBSIRU-UHFFFAOYSA-L |
| XLogP | -1.26 |
| TPSA | 210.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|