C19H18Cl2N2O4 — CID 166903417
(2S)-2,3-bis[[2-(4-chlorophenyl)acetyl]amino]propanoic acid (PubChem CID 166903417) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is (2S)-2,3-bis[[2-(4-chlorophenyl)acetyl]amino]propanoic acid.
| Compound Name | (2S)-2,3-bis[[2-(4-chlorophenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166903417 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (2S)-2,3-bis[[2-(4-chlorophenyl)acetyl]amino]propanoic acid |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H18Cl2N2O4/c20-14-5-1-12(2-6-14)9-17(24)22-11-16(19(26)27)23-18(25)10-13-3-7-15(21)8-4-13/h1-8,16H,9-11H2,(H,22,24)(H,23,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | OSYNHPMZPLMMAN-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |