C23H19Cl3N2O2 — CID 71459140
2-(4-chlorophenyl)-N-[(4-chlorophenyl)-[[2-(4-chlorophenyl)acetyl]amino]methyl]acetamide (PubChem CID 71459140) has the molecular formula C23H19Cl3N2O2 and a molecular weight of 461.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(4-chlorophenyl)-[[2-(4-chlorophenyl)acetyl]amino]methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(4-chlorophenyl)-[[2-(4-chlorophenyl)acetyl]amino]methyl]acetamide |
|---|---|
| PubChem CID | 71459140 |
| Molecular Formula | C23H19Cl3N2O2 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(4-chlorophenyl)-[[2-(4-chlorophenyl)acetyl]amino]methyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(NC(=O)Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19Cl3N2O2/c24-18-7-1-15(2-8-18)13-21(29)27-23(17-5-11-20(26)12-6-17)28-22(30)14-16-3-9-19(25)10-4-16/h1-12,23H,13-14H2,(H,27,29)(H,28,30) |
| InChIKey | NQQRRINIHNBRSU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|