C19H22Cl2N2O — CID 110278648
2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]acetamide (PubChem CID 110278648) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 110278648 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCC(NC(=O)Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-23(2)12-11-18(15-5-9-17(21)10-6-15)22-19(24)13-14-3-7-16(20)8-4-14/h3-10,18H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | YUKQIELMDFTISM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |