C20H24ClFN2O — CID 110278571
N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(4-fluorophenyl)propanamide (PubChem CID 110278571) has the molecular formula C20H24ClFN2O and a molecular weight of 362.88 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 110278571 |
| Molecular Formula | C20H24ClFN2O |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CN(C)CCC(NC(=O)CCc1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClFN2O/c1-24(2)14-13-19(16-6-8-17(21)9-7-16)23-20(25)12-5-15-3-10-18(22)11-4-15/h3-4,6-11,19H,5,12-14H2,1-2H3,(H,23,25) |
| InChIKey | CSOUWKHEXZEWPQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |