C20H31ClN2O — CID 110278624
N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-cyclohexylpropanamide (PubChem CID 110278624) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-cyclohexylpropanamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 110278624 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-cyclohexylpropanamide |
| SMILES | CN(C)CCC(NC(=O)CCC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H31ClN2O/c1-23(2)15-14-19(17-9-11-18(21)12-10-17)22-20(24)13-8-16-6-4-3-5-7-16/h9-12,16,19H,3-8,13-15H2,1-2H3,(H,22,24) |
| InChIKey | PAGJSLHLAICVLN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |