C9H11ClO3 — CID 141006599
5-chloro-4-hydroxy-5,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 141006599) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is 5-chloro-4-hydroxy-5,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-chloro-4-hydroxy-5,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141006599 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-chloro-4-hydroxy-5,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=C(O)C1(C)Cl |
| InChI | InChI=1S/C9H11ClO3/c1-5-6(8(12)13)3-4-7(11)9(5,2)10/h3-5,11H,1-2H3,(H,12,13) |
| InChIKey | HFMXBCLVYBXFQH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|