About 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid
4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 53427142) has the molecular formula C7H7ClO4
and a molecular weight of 190.58 g/mol. Its IUPAC name is 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.
Analyze 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (CID 53427142) is 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC=C(Cl)C(O)C1O.
What is the InChIKey of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is HLOVYSNZOSWZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO4/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,5-6,9-10H,(H,11,12).
What are the key properties of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 190.58 g/mol, XLogP of -0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 53427142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).