4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid

C7H7ClO4 — CID 53427142

IUPAC4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid
SMILESO=C(O)C1=CC=C(Cl)C(O)C1O
InChIInChI=1S/C7H7ClO4/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,5-6,9-10H,(H,11,12)
InChIKeyHLOVYSNZOSWZCM-UHFFFAOYSA-N
MW190.58 g/mol
LogP-0.14
Rot. Bonds1

About 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid

4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 53427142) has the molecular formula C7H7ClO4 and a molecular weight of 190.58 g/mol. Its IUPAC name is 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid
PubChem CID53427142
Molecular FormulaC7H7ClO4
Molecular Weight190.58 g/mol
Exact Mass190.00
IUPAC Name4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid
SMILESO=C(O)C1=CC=C(Cl)C(O)C1O
InChIInChI=1S/C7H7ClO4/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,5-6,9-10H,(H,11,12)
InChIKeyHLOVYSNZOSWZCM-UHFFFAOYSA-N
XLogP-0.14
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.58
LogP ≤ 5-0.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (CID 53427142) is 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC=C(Cl)C(O)C1O.
What is the InChIKey of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is HLOVYSNZOSWZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO4/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,5-6,9-10H,(H,11,12).
What are the key properties of 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid?
4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 190.58 g/mol, XLogP of -0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 53427142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).