C8H7ClO3 — CID 141006592
6-chloro-5-hydroxybicyclo[4.1.0]hepta-2,4-diene-2-carboxylic acid (PubChem CID 141006592) has the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. Its IUPAC name is 6-chloro-5-hydroxybicyclo[4.1.0]hepta-2,4-diene-2-carboxylic acid.
| Compound Name | 6-chloro-5-hydroxybicyclo[4.1.0]hepta-2,4-diene-2-carboxylic acid |
|---|---|
| PubChem CID | 141006592 |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 6-chloro-5-hydroxybicyclo[4.1.0]hepta-2,4-diene-2-carboxylic acid |
| SMILES | O=C(O)C1=CC=C(O)C2(Cl)CC12 |
| InChI | InChI=1S/C8H7ClO3/c9-8-3-5(8)4(7(11)12)1-2-6(8)10/h1-2,5,10H,3H2,(H,11,12) |
| InChIKey | DUZMHAAWRUFEGS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|