C16H11ClO2 — CID 139617766
1a-chloro-1,9b-dihydrocyclopropa[a]anthracene-2-carboxylic acid (PubChem CID 139617766) has the molecular formula C16H11ClO2 and a molecular weight of 270.71 g/mol. Its IUPAC name is 1a-chloro-1,9b-dihydrocyclopropa[a]anthracene-2-carboxylic acid.
| Compound Name | 1a-chloro-1,9b-dihydrocyclopropa[a]anthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 139617766 |
| Molecular Formula | C16H11ClO2 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1a-chloro-1,9b-dihydrocyclopropa[a]anthracene-2-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc3ccccc3cc2C2CC12Cl |
| InChI | InChI=1S/C16H11ClO2/c17-16-8-14(16)12-6-10-4-2-1-3-9(10)5-11(12)7-13(16)15(18)19/h1-7,14H,8H2,(H,18,19) |
| InChIKey | WQDKOJUIXXGNFQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|