C14H10O — CID 135059450
(1aS,9bR)-1a,9b-dihydroanthra[1,2-b]oxirene (PubChem CID 135059450) has the molecular formula C14H10O and a molecular weight of 194.23 g/mol. Its IUPAC name is (1aS,9bR)-1a,9b-dihydroanthra[1,2-b]oxirene.
| Compound Name | (1aS,9bR)-1a,9b-dihydroanthra[1,2-b]oxirene |
|---|---|
| PubChem CID | 135059450 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (1aS,9bR)-1a,9b-dihydroanthra[1,2-b]oxirene |
| SMILES | C1=C[C@@H]2O[C@@H]2c2cc3ccccc3cc21 |
| InChI | InChI=1S/C14H10O/c1-2-4-10-8-12-11(7-9(10)3-1)5-6-13-14(12)15-13/h1-8,13-14H/t13-,14+/m0/s1 |
| InChIKey | YDFLROSXCLHLJV-UONOGXRCSA-N |
| XLogP | 3.31 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|