C24H21NO — CID 15306395
(3aS,11bS)-1-(2,4,6-trimethylphenyl)-3a,11b-dihydronaphtho[2,3-e][1,2]benzoxazole (PubChem CID 15306395) has the molecular formula C24H21NO and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aS,11bS)-1-(2,4,6-trimethylphenyl)-3a,11b-dihydronaphtho[2,3-e][1,2]benzoxazole.
| Compound Name | (3aS,11bS)-1-(2,4,6-trimethylphenyl)-3a,11b-dihydronaphtho[2,3-e][1,2]benzoxazole |
|---|---|
| PubChem CID | 15306395 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3aS,11bS)-1-(2,4,6-trimethylphenyl)-3a,11b-dihydronaphtho[2,3-e][1,2]benzoxazole |
| SMILES | Cc1cc(C)c(C2=NO[C@H]3C=Cc4cc5ccccc5cc4[C@@H]23)c(C)c1 |
| InChI | InChI=1S/C24H21NO/c1-14-10-15(2)22(16(3)11-14)24-23-20-13-18-7-5-4-6-17(18)12-19(20)8-9-21(23)26-25-24/h4-13,21,23H,1-3H3/t21-,23+/m0/s1 |
| InChIKey | ABLRCWLZNHWWHY-JTHBVZDNSA-N |
| XLogP | 5.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |