C24H22N2O3 — CID 10620179
(4R,5R)-5-(4-nitrophenyl)-4-phenyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 10620179) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is (4R,5R)-5-(4-nitrophenyl)-4-phenyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (4R,5R)-5-(4-nitrophenyl)-4-phenyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10620179 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (4R,5R)-5-(4-nitrophenyl)-4-phenyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Cc1cc(C)c(C2=NO[C@@H](c3ccc([N+](=O)[O-])cc3)[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H22N2O3/c1-15-13-16(2)21(17(3)14-15)23-22(18-7-5-4-6-8-18)24(29-25-23)19-9-11-20(12-10-19)26(27)28/h4-14,22,24H,1-3H3/t22-,24+/m1/s1 |
| InChIKey | GWRZDSYJBVATRD-VWNXMTODSA-N |
| XLogP | 5.78 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|