C7H6Cl2O2 — CID 131701176
5,6-dichloro-4,5,6-trideuteriocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 131701176) has the molecular formula C7H6Cl2O2 and a molecular weight of 196.05 g/mol. Its IUPAC name is 5,6-dichloro-4,5,6-trideuteriocyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5,6-dichloro-4,5,6-trideuteriocyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 131701176 |
| Molecular Formula | C7H6Cl2O2 |
| Molecular Weight | 196.05 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 5,6-dichloro-4,5,6-trideuteriocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | [2H]C1=CC=C(C(=O)O)C([2H])(Cl)C1([2H])Cl |
| InChI | InChI=1S/C7H6Cl2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,5-6H,(H,10,11)/i3D,5D,6D |
| InChIKey | HYNXYFMTLDQRQV-LPZFHNFMSA-N |
| XLogP | 1.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.05 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|