C7H7NO5S — CID 87845043
6-aminooxy-5-sulfonylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 87845043) has the molecular formula C7H7NO5S and a molecular weight of 217.20 g/mol. Its IUPAC name is 6-aminooxy-5-sulfonylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 6-aminooxy-5-sulfonylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 87845043 |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 6-aminooxy-5-sulfonylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | NOC1C(C(=O)O)=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C7H7NO5S/c8-13-6-4(7(9)10)2-1-3-5(6)14(11)12/h1-3,6H,8H2,(H,9,10) |
| InChIKey | FIRPVSWFGNTRJZ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|