C13H10O4S — CID 141113520
2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141113520) has the molecular formula C13H10O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141113520 |
| Molecular Formula | C13H10O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2ccccc2)=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C13H10O4S/c14-13(15)12-10(9-5-2-1-3-6-9)7-4-8-11(12)18(16)17/h1-8,12H,(H,14,15) |
| InChIKey | HRGPMRPSKAWLFM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|