2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid

C13H10O4S — CID 141113520

IUPAC2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C(c2ccccc2)=CC=CC1=S(=O)=O
InChIInChI=1S/C13H10O4S/c14-13(15)12-10(9-5-2-1-3-6-9)7-4-8-11(12)18(16)17/h1-8,12H,(H,14,15)
InChIKeyHRGPMRPSKAWLFM-UHFFFAOYSA-N
MW262.29 g/mol
LogP1.39
Rot. Bonds2

About 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid

2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141113520) has the molecular formula C13H10O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid
PubChem CID141113520
Molecular FormulaC13H10O4S
Molecular Weight262.29 g/mol
Exact Mass262.03
IUPAC Name2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C(c2ccccc2)=CC=CC1=S(=O)=O
InChIInChI=1S/C13H10O4S/c14-13(15)12-10(9-5-2-1-3-6-9)7-4-8-11(12)18(16)17/h1-8,12H,(H,14,15)
InChIKeyHRGPMRPSKAWLFM-UHFFFAOYSA-N
XLogP1.39
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.29
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (CID 141113520) is 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C(c2ccccc2)=CC=CC1=S(=O)=O.
What is the InChIKey of 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is HRGPMRPSKAWLFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O4S/c14-13(15)12-10(9-5-2-1-3-6-9)7-4-8-11(12)18(16)17/h1-8,12H,(H,14,15).
What are the key properties of 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 262.29 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 141113520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).