About (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate
(1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate (PubChem CID 140998474) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate.
Analyze (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate?
The IUPAC name of (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate (CID 140998474) is (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate.
What is the SMILES notation for (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate?
The canonical SMILES for (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate is CC1C(c2ccccc2)=CC=CC1(C)OC(=O)O.
What is the InChIKey of (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate?
The InChIKey is PXRUDODZTKGEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3/c1-11-13(12-7-4-3-5-8-12)9-6-10-15(11,2)18-14(16)17/h3-11H,1-2H3,(H,16,17).
What are the key properties of (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate?
(1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate has a molecular weight of 244.29 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl) hydrogen carbonate is sourced from PubChem (CID 140998474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).