C17H21ClO2 — CID 175341325
[1-(3-chloropropoxy)-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]methanol (PubChem CID 175341325) has the molecular formula C17H21ClO2 and a molecular weight of 292.81 g/mol. Its IUPAC name is [1-(3-chloropropoxy)-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [1-(3-chloropropoxy)-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 175341325 |
| Molecular Formula | C17H21ClO2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [1-(3-chloropropoxy)-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CC1C(c2ccccc2)=CC=CC1(CO)OCCCCl |
| InChI | InChI=1S/C17H21ClO2/c1-14-16(15-7-3-2-4-8-15)9-5-10-17(14,13-19)20-12-6-11-18/h2-5,7-10,14,19H,6,11-13H2,1H3 |
| InChIKey | PQMZBHZKMJWDAI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|