1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid

C8H8O4 — CID 176902272

IUPAC1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILES[2H]C1(C(=O)O)C=CC=C(C(=O)O)C1
InChIInChI=1S/C8H8O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-3,5H,4H2,(H,9,10)(H,11,12)/i5D
InChIKeyOWLRKWMPQLTNIE-UICOGKGYSA-N
MW169.15 g/mol
LogP0.66
Rot. Bonds2

About 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid

1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 176902272) has the molecular formula C8H8O4 and a molecular weight of 169.15 g/mol. Its IUPAC name is 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid
PubChem CID176902272
Molecular FormulaC8H8O4
Molecular Weight169.15 g/mol
Exact Mass169.05
IUPAC Name1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILES[2H]C1(C(=O)O)C=CC=C(C(=O)O)C1
InChIInChI=1S/C8H8O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-3,5H,4H2,(H,9,10)(H,11,12)/i5D
InChIKeyOWLRKWMPQLTNIE-UICOGKGYSA-N
XLogP0.66
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.15
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 176902272) is 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid is [2H]C1(C(=O)O)C=CC=C(C(=O)O)C1.
What is the InChIKey of 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is OWLRKWMPQLTNIE-UICOGKGYSA-N. The full InChI is InChI=1S/C8H8O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-3,5H,4H2,(H,9,10)(H,11,12)/i5D.
What are the key properties of 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid?
1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 169.15 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuteriocyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 176902272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).